cas: 195447-79-1 — see every product listed under this CAS number, including other names
3-Fluoro-5-(trifluoromethyl)phenylacetic acid, 97% (CAS 195447-79-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F006438-1G |
| cas | 195447-79-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 10g | 419.66 Pln | |
| Fluorochem | 25g | 955.93 Pln | |
| Fluorochem | 100g | 3376.95 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-[3-fluoro-5-(trifluoromethyl)phenyl]acetic acid (CAS 195447-79-1) is a chemical compound with the molecular formula C9H6F4O2 and a molecular weight of 222.14 g/mol. IUPAC name: 2-[3-fluoro-5-(trifluoromethyl)phenyl]acetic acid. InChIKey: LQIBHDUPSIQRPV-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O2 |
|---|---|
| Molecular weight | 222.14 g/mol |
| IUPAC name | 2-[3-fluoro-5-(trifluoromethyl)phenyl]acetic acid |
| InChIKey | LQIBHDUPSIQRPV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)F)CC(=O)O |
Computed by PubChem (NCBI)