cas: 2121511-42-8 — see every product listed under this CAS number, including other names
3-Fluoro-N,N-diethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 2121511-42-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627775-250MG |
| cas | 2121511-42-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 6349.87 Pln | |
| Fluorochem | 500mg | 7214.14 Pln |
| delivery time | 3-4 weeks |
|---|
N,N-diethyl-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (CAS 2121511-42-8) is a chemical compound with the molecular formula C16H25BFNO2 and a molecular weight of 293.2 g/mol. IUPAC name: N,N-diethyl-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline. InChIKey: FCHYRPIBXPBNKN-UHFFFAOYSA-N.
| Molecular formula | C16H25BFNO2 |
|---|---|
| Molecular weight | 293.2 g/mol |
| IUPAC name | N,N-diethyl-3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| InChIKey | FCHYRPIBXPBNKN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)F)N(CC)CC |
Computed by PubChem (NCBI)