CAS 2377609-37-3 is the registry number for 3-Fluoro-4-(propylaminomethyl)phenylboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]propan-1-amine (CAS 2377609-37-3) is a chemical compound with the molecular formula C16H25BFNO2 and a molecular weight of 293.2 g/mol. IUPAC name: N-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]propan-1-amine. InChIKey: RVOYPFBSFWXVAM-UHFFFAOYSA-N.
| Molecular formula | C16H25BFNO2 |
|---|---|
| Molecular weight | 293.2 g/mol |
| IUPAC name | N-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]propan-1-amine |
| InChIKey | RVOYPFBSFWXVAM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)CNCCC)F |
Computed by PubChem (NCBI)