cas: 75207-72-6 — see every product listed under this CAS number, including other names
3-Fluorobenzenecarboximidamidehydrochloride, 98% (CAS 75207-72-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F061480-1G |
| cas | 75207-72-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 195.78 Pln | |
| Fluorochem | 5g | 388.42 Pln | |
| Fluorochem | 10g | 664.37 Pln | |
| Fluorochem | 25g | 1570.30 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3-fluorobenzenecarboximidamide;hydrochloride (CAS 75207-72-6) is a chemical compound with the molecular formula C7H8ClFN2 and a molecular weight of 174.60 g/mol. IUPAC name: 3-fluorobenzenecarboximidamide;hydrochloride. InChIKey: KISQHILAOJSVET-UHFFFAOYSA-N.
| Molecular formula | C7H8ClFN2 |
|---|---|
| Molecular weight | 174.60 g/mol |
| IUPAC name | 3-fluorobenzenecarboximidamide;hydrochloride |
| InChIKey | KISQHILAOJSVET-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(=N)N.Cl |
Computed by PubChem (NCBI)