cas: 75207-72-6 — see every product listed under this CAS number, including other names
3-Fluorobenzimidamide hydrochloride, 98%, 98% (CAS 75207-72-6) is a chemical reagent available from Chemat. Available pack sizes: 100g, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ICM0-100g |
| cas | 75207-72-6 |
| size | 100g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 3045.20 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 246.80 Pln | |
| Chemat | 25g | 995.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-fluorobenzenecarboximidamide;hydrochloride (CAS 75207-72-6) is a chemical compound with the molecular formula C7H8ClFN2 and a molecular weight of 174.60 g/mol. IUPAC name: 3-fluorobenzenecarboximidamide;hydrochloride. InChIKey: KISQHILAOJSVET-UHFFFAOYSA-N.
| Molecular formula | C7H8ClFN2 |
|---|---|
| Molecular weight | 174.60 g/mol |
| IUPAC name | 3-fluorobenzenecarboximidamide;hydrochloride |
| InChIKey | KISQHILAOJSVET-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(=N)N.Cl |
Computed by PubChem (NCBI)