cas: 26347-98-8 — see every product listed under this CAS number, including other names
3-Hydroxy-2,2-bis(hydroxymethyl)propyl 3-(3,5-di-tert-butyl-4-hydroxyphenyl)propanoate 97% (CAS 26347-98-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1151859-5g |
| cas | 26347-98-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 7551.56 Pln | |
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 709.69 Pln | |
| Ambeed | 1g | 1939.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1151859 |
[3-hydroxy-2,2-bis(hydroxymethyl)propyl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (CAS 26347-98-8) is a chemical compound with the molecular formula C22H36O6 and a molecular weight of 396.5 g/mol. IUPAC name: [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate. InChIKey: RQYISMPLEFNMLU-UHFFFAOYSA-N.
| Molecular formula | C22H36O6 |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| InChIKey | RQYISMPLEFNMLU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)CCC(=O)OCC(CO)(CO)CO |
Computed by PubChem (NCBI)