cas: 26347-98-8 — see every product listed under this CAS number, including other names
Benzenepropanoic acid, 3,5-bis(1,1-dimethylethyl)-4-hydroxy-, 3-hydroxy-2,2-bis(hydroxymethyl)propyl ester, 95%, 95% (CAS 26347-98-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114APB-25mg |
| cas | 26347-98-8 |
| size | 25mg |
| availability | 1.55g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 232.40 Pln | |
| Chemat | 50mg | 270.80 Pln | |
| Chemat | 100mg | 304.40 Pln | |
| Chemat | 250mg | 539.60 Pln | |
| Chemat | 1g | 1442.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[3-hydroxy-2,2-bis(hydroxymethyl)propyl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (CAS 26347-98-8) is a chemical compound with the molecular formula C22H36O6 and a molecular weight of 396.5 g/mol. IUPAC name: [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate. InChIKey: RQYISMPLEFNMLU-UHFFFAOYSA-N.
| Molecular formula | C22H36O6 |
|---|---|
| Molecular weight | 396.5 g/mol |
| IUPAC name | [3-hydroxy-2,2-bis(hydroxymethyl)propyl] 3-(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| InChIKey | RQYISMPLEFNMLU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1O)C(C)(C)C)CCC(=O)OCC(CO)(CO)CO |
Computed by PubChem (NCBI)