cas: 193693-95-7 — see every product listed under this CAS number, including other names
3-Hydroxy-5-nitrobenzaldehyde 95% (CAS 193693-95-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A147039-100mg |
| cas | 193693-95-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 364.81 Pln | |
| Ambeed | 250mg | 592.88 Pln | |
| Ambeed | 1g | 1460.62 Pln | |
| Ambeed | 5g | 5293.19 Pln | |
| Ambeed | 10g | 9759.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A147039 |
3-hydroxy-5-nitrobenzaldehyde (CAS 193693-95-7) is a chemical compound with the molecular formula C7H5NO4 and a molecular weight of 167.12 g/mol. IUPAC name: 3-hydroxy-5-nitrobenzaldehyde. InChIKey: QAGPTXBGYDEOFQ-UHFFFAOYSA-N.
| Molecular formula | C7H5NO4 |
|---|---|
| Molecular weight | 167.12 g/mol |
| IUPAC name | 3-hydroxy-5-nitrobenzaldehyde |
| InChIKey | QAGPTXBGYDEOFQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1[N+](=O)[O-])O)C=O |
Computed by PubChem (NCBI)