CAS 1369340-70-4 is the registry number for [1,3]Dioxolo[4,5-c]pyridine-4-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[1,3]dioxolo[4,5-c]pyridine-4-carboxylic acid (CAS 1369340-70-4) is a chemical compound with the molecular formula C7H5NO4 and a molecular weight of 167.12 g/mol. IUPAC name: [1,3]dioxolo[4,5-c]pyridine-4-carboxylic acid. InChIKey: ORSXOWBJPPWGAJ-UHFFFAOYSA-N.
| Molecular formula | C7H5NO4 |
|---|---|
| Molecular weight | 167.12 g/mol |
| IUPAC name | [1,3]dioxolo[4,5-c]pyridine-4-carboxylic acid |
| InChIKey | ORSXOWBJPPWGAJ-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=NC=C2)C(=O)O |
Computed by PubChem (NCBI)