cas: 116574-71-1 — see every product listed under this CAS number, including other names
3-Hydroxymethyl-1-N-Boc-piperidine, 95% (CAS 116574-71-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040646-1G |
| cas | 116574-71-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 91.65 Pln | |
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 25g | 128.10 Pln | |
| Fluorochem | 100g | 346.77 Pln | |
| Fluorochem | 500g | 1450.55 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl 3-(hydroxymethyl)piperidine-1-carboxylate (CAS 116574-71-1) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl 3-(hydroxymethyl)piperidine-1-carboxylate. InChIKey: OJCLHERKFHHUTB-UHFFFAOYSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl 3-(hydroxymethyl)piperidine-1-carboxylate |
| InChIKey | OJCLHERKFHHUTB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)CO |
Computed by PubChem (NCBI)