cas: 116574-71-1 — see every product listed under this CAS number, including other names
tert-Butyl 3-(hydroxymethyl)piperidine-1-carboxylate, 98%, 98% (CAS 116574-71-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HDQG-1g |
| cas | 116574-71-1 |
| size | 1g |
| availability | 853g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 102.80 Pln | |
| Chemat | 100g | 227.60 Pln | |
| Chemat | 500g | 960.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-(hydroxymethyl)piperidine-1-carboxylate (CAS 116574-71-1) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl 3-(hydroxymethyl)piperidine-1-carboxylate. InChIKey: OJCLHERKFHHUTB-UHFFFAOYSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl 3-(hydroxymethyl)piperidine-1-carboxylate |
| InChIKey | OJCLHERKFHHUTB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)CO |
Computed by PubChem (NCBI)