cas: 135-51-3 — see every product listed under this CAS number, including other names
3-Hydroxynaphthalene-2,7-disulfonic acid disodium salt, 85%, 85% (CAS 135-51-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 50g, 75g, 100g, 200g, 300g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114HRC-5g |
| cas | 135-51-3 |
| size | 5g |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 69.20 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 50g | 117.20 Pln | |
| Chemat | 75g | 146.00 Pln | |
| Chemat | 100g | 160.40 Pln | |
| Chemat | 200g | 251.60 Pln | |
| Chemat | 300g | 342.80 Pln | |
| Chemat | 500g | 523.20 Pln |
| purity | 85% |
|---|---|
| delivery time | 3 weeks |
Disodium;3-hydroxynaphthalene-2,7-disulfonate (CAS 135-51-3) is a chemical compound with the molecular formula C10H6Na2O7S2 and a molecular weight of 348.3 g/mol. IUPAC name: disodium;3-hydroxynaphthalene-2,7-disulfonate. InChIKey: VNEBWJSWMVTSHK-UHFFFAOYSA-L.
| Molecular formula | C10H6Na2O7S2 |
|---|---|
| Molecular weight | 348.3 g/mol |
| IUPAC name | disodium;3-hydroxynaphthalene-2,7-disulfonate |
| InChIKey | VNEBWJSWMVTSHK-UHFFFAOYSA-L |
| SMILES | C1=CC(=CC2=CC(=C(C=C21)O)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)