CAS 20349-39-7 is the registry number for Sodium 4-hydroxynaphthalene-2,7-disulfonate, 50%, 50%. Offered by: Chemat. Available pack sizes: 1g, 5g, 100g, 500g, 25g.
Disodium;4-hydroxynaphthalene-2,7-disulfonate (CAS 20349-39-7) is a chemical compound with the molecular formula C10H6Na2O7S2 and a molecular weight of 348.3 g/mol. IUPAC name: disodium;4-hydroxynaphthalene-2,7-disulfonate. InChIKey: RJMDNLVCFLKDBY-UHFFFAOYSA-L.
| Molecular formula | C10H6Na2O7S2 |
|---|---|
| Molecular weight | 348.3 g/mol |
| IUPAC name | disodium;4-hydroxynaphthalene-2,7-disulfonate |
| InChIKey | RJMDNLVCFLKDBY-UHFFFAOYSA-L |
| SMILES | C1=CC2=C(C=C(C=C2C=C1S(=O)(=O)[O-])S(=O)(=O)[O-])O.[Na+].[Na+] |
Computed by PubChem (NCBI)