3-Iodo-4-(trifluoromethoxy)benzoic acid, 95%
cas: 1110709-70-0 — see every product listed under this CAS number, including other names
3-Iodo-4-(trifluoromethoxy)benzoic acid, 95% (CAS 1110709-70-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A847717-250mg |
| cas | 1110709-70-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 898.81 Pln | |
| Ambeed | 5g | 3885.87 Pln | |
| BLDpharm | 100mg | 203.29 Pln | |
| BLDpharm | 250mg | 319.91 Pln | |
| BLDpharm | 1g | 964.13 Pln | |
| BLDpharm | 5g | 4185.22 Pln | |
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 1g | 726.85 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-iodo-4-(trifluoromethoxy)benzoic acid (CAS 1110709-70-0) is a chemical compound with the molecular formula C8H4F3IO3 and a molecular weight of 332.01 g/mol. IUPAC name: 3-iodo-4-(trifluoromethoxy)benzoic acid. InChIKey: HDYICWVGSFIFDM-UHFFFAOYSA-N.
| Molecular formula | C8H4F3IO3 |
|---|---|
| Molecular weight | 332.01 g/mol |
| IUPAC name | 3-iodo-4-(trifluoromethoxy)benzoic acid |
| InChIKey | HDYICWVGSFIFDM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)I)OC(F)(F)F |
Computed by PubChem (NCBI)