CAS 775330-11-5 is the registry number for 2-Hydroxy-3-iodo-5-(trifluoromethoxy)benzaldehyde, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
2-hydroxy-3-iodo-5-(trifluoromethoxy)benzaldehyde (CAS 775330-11-5) is a chemical compound with the molecular formula C8H4F3IO3 and a molecular weight of 332.01 g/mol. IUPAC name: 2-hydroxy-3-iodo-5-(trifluoromethoxy)benzaldehyde. InChIKey: KUVGGCSYLYHROK-UHFFFAOYSA-N.
| Molecular formula | C8H4F3IO3 |
|---|---|
| Molecular weight | 332.01 g/mol |
| IUPAC name | 2-hydroxy-3-iodo-5-(trifluoromethoxy)benzaldehyde |
| InChIKey | KUVGGCSYLYHROK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=O)O)I)OC(F)(F)F |
Computed by PubChem (NCBI)