cas: 1142192-57-1 — see every product listed under this CAS number, including other names
3-Iodo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine (CAS 1142192-57-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F233261-100MG |
| cas | 1142192-57-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 362.39 Pln | |
| Fluorochem | 250mg | 601.89 Pln | |
| Fluorochem | 500mg | 825.77 Pln |
| delivery time | 3-4 weeks |
|---|
3-iodo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine (CAS 1142192-57-1) is a chemical compound with the molecular formula C8H4F3IN2 and a molecular weight of 312.03 g/mol. IUPAC name: 3-iodo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine. InChIKey: NSRVALWCFIYTLR-UHFFFAOYSA-N.
| Molecular formula | C8H4F3IN2 |
|---|---|
| Molecular weight | 312.03 g/mol |
| IUPAC name | 3-iodo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | NSRVALWCFIYTLR-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC2=C1C(=CN2)I)C(F)(F)F |
Computed by PubChem (NCBI)