CAS 1261365-97-2 appears in our catalog under these names: 4-Iodo-5-(trifluoromethyl)-1h-pyrrolo[2,3-b]pyridine, 95%, 4-Iodo-5-(trifluoromethyl)-1H-pyrrolo(2,3-b)pyridine, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
4-iodo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine (CAS 1261365-97-2) is a chemical compound with the molecular formula C8H4F3IN2 and a molecular weight of 312.03 g/mol. IUPAC name: 4-iodo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine. InChIKey: GYRRXQBOUNXNLU-UHFFFAOYSA-N.
| Molecular formula | C8H4F3IN2 |
|---|---|
| Molecular weight | 312.03 g/mol |
| IUPAC name | 4-iodo-5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | GYRRXQBOUNXNLU-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC=C(C(=C21)I)C(F)(F)F |
Computed by PubChem (NCBI)