cas: 1892533-73-1 — see every product listed under this CAS number, including other names
3-Iodo-7-(trifluoromethyl)-1H-indazole, 97% (CAS 1892533-73-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A486638-5g |
| cas | 1892533-73-1 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10531.57 Pln | |
| AmBeed | 10g | 17503.78 Pln | |
| AmBeed | 1g | 3246.88 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-iodo-7-(trifluoromethyl)-2H-indazole (CAS 1892533-73-1) is a chemical compound with the molecular formula C8H4F3IN2 and a molecular weight of 312.03 g/mol. IUPAC name: 3-iodo-7-(trifluoromethyl)-2H-indazole. InChIKey: UIMQMUWZZHZEIL-UHFFFAOYSA-N.
| Molecular formula | C8H4F3IN2 |
|---|---|
| Molecular weight | 312.03 g/mol |
| IUPAC name | 3-iodo-7-(trifluoromethyl)-2H-indazole |
| InChIKey | UIMQMUWZZHZEIL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NN=C2C(=C1)C(F)(F)F)I |
Computed by PubChem (NCBI)