Products 352526-01-3

CAS 352526-01-3 appears in our catalog under these names: 3-Mercaptophenylboronic acid, 98%, 3-Thiobenzeneboronic acid 95%, 3-MERCAPTOPHENYLBORONIC ACID, ≥95%, (3-Mercaptophenyl)boronic acid, 95%, 95%, 3-Mercaptophenylboronic Acid (contains varying amounts of Anhydride). Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat, TCI. Available pack sizes: 1g, 25g, 10g, 5g, 250mg.

Structural formula: {0} (CAS {1})

(3-sulfanylphenyl)boronic acid (CAS 352526-01-3) is a chemical compound with the molecular formula C6H7BO2S and a molecular weight of 154.00 g/mol. IUPAC name: (3-sulfanylphenyl)boronic acid. InChIKey: OBCKMTLUSKYKIW-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7BO2S
Molecular weight154.00 g/mol
IUPAC name(3-sulfanylphenyl)boronic acid
InChIKeyOBCKMTLUSKYKIW-UHFFFAOYSA-N
SMILESB(C1=CC(=CC=C1)S)(O)O

Computed by PubChem (NCBI)