Products 237429-33-3

CAS 237429-33-3 appears in our catalog under these names: 4-Mercaptophenylboronic acid, 97%, 4–Mercaptophenylboronic Acid (contains varying amounts of Anhydride), 4-Mercaptophenylboronic Acid (contains varying amounts of Anhydride), 4-Mercaptophenylboronic acid, 4-Mercaptophenylboronic acid 95%. Offered by: Combi-blocks, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 1g, 25g, 10g, 100g, 5g, 200mg, 50g, 250g.

Structural formula: {0} (CAS {1})

(4-sulfanylphenyl)boronic acid (CAS 237429-33-3) is a chemical compound with the molecular formula C6H7BO2S and a molecular weight of 154.00 g/mol. IUPAC name: (4-sulfanylphenyl)boronic acid. InChIKey: AUVSUPMVIZXUOG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7BO2S
Molecular weight154.00 g/mol
IUPAC name(4-sulfanylphenyl)boronic acid
InChIKeyAUVSUPMVIZXUOG-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)S)(O)O

Computed by PubChem (NCBI)