cas: 1416367-04-8 — see every product listed under this CAS number, including other names
3-METHANESULFINYLPHENYLBORONIC ACID, PINACOL ESTER, 95% (CAS 1416367-04-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F513797-250MG |
| cas | 1416367-04-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 346.77 Pln | |
| Fluorochem | 5g | 1200.64 Pln | |
| Fluorochem | 10g | 2346.07 Pln | |
| Fluorochem | 25g | 5751.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4,4,5,5-tetramethyl-2-(3-methylsulfinylphenyl)-1,3,2-dioxaborolane (CAS 1416367-04-8) is a chemical compound with the molecular formula C13H19BO3S and a molecular weight of 266.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-methylsulfinylphenyl)-1,3,2-dioxaborolane. InChIKey: WRVNLMRGJRLGQE-UHFFFAOYSA-N.
| Molecular formula | C13H19BO3S |
|---|---|
| Molecular weight | 266.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3-methylsulfinylphenyl)-1,3,2-dioxaborolane |
| InChIKey | WRVNLMRGJRLGQE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)S(=O)C |
Computed by PubChem (NCBI)