CAS 1416367-04-8 appears in our catalog under these names: 3-Methanesulfinylphenylboronic acid, pinacol ester, 98%, 3–Methanesulfinylphenylboronic Acid Pinacol Ester, 4,4,5,5-Tetramethyl-2-(3-(methylsulfinyl)phenyl)-1,3,2-dioxaborolane 98%, 4,4,5,5-Tetramethyl-2-(3-(methylsulfinyl)phenyl)-1,3,2-dioxaborolane, 98%, 98%, 3-METHANESULFINYLPHENYLBORONIC ACID, PINACOL ESTER, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g, 10g.
4,4,5,5-tetramethyl-2-(3-methylsulfinylphenyl)-1,3,2-dioxaborolane (CAS 1416367-04-8) is a chemical compound with the molecular formula C13H19BO3S and a molecular weight of 266.2 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(3-methylsulfinylphenyl)-1,3,2-dioxaborolane. InChIKey: WRVNLMRGJRLGQE-UHFFFAOYSA-N.
| Molecular formula | C13H19BO3S |
|---|---|
| Molecular weight | 266.2 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(3-methylsulfinylphenyl)-1,3,2-dioxaborolane |
| InChIKey | WRVNLMRGJRLGQE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)S(=O)C |
Computed by PubChem (NCBI)