cas: 273207-57-1 — see every product listed under this CAS number, including other names
3-METHYLENE-8-BOC-8-AZABICYCLO[3.2.1]OCTANE, 98% (CAS 273207-57-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F503326-100MG |
| cas | 273207-57-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 362.39 Pln | |
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 1g | 935.11 Pln | |
| Fluorochem | 5g | 3038.53 Pln | |
| Fluorochem | 10g | 6027.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-methylidene-8-azabicyclo[3.2.1]octane-8-carboxylate (CAS 273207-57-1) is a chemical compound with the molecular formula C13H21NO2 and a molecular weight of 223.31 g/mol. IUPAC name: tert-butyl 3-methylidene-8-azabicyclo[3.2.1]octane-8-carboxylate. InChIKey: ZYNYREKPRWPYDC-UHFFFAOYSA-N.
| Molecular formula | C13H21NO2 |
|---|---|
| Molecular weight | 223.31 g/mol |
| IUPAC name | tert-butyl 3-methylidene-8-azabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | ZYNYREKPRWPYDC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2CCC1CC(=C)C2 |
Computed by PubChem (NCBI)