cas: 51238-86-9 — see every product listed under this CAS number, including other names
3-Methoxy-1,5-diphenyl-1-pentanone, 95%+, 95%+ (CAS 51238-86-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12HVPL-100mg |
| cas | 51238-86-9 |
| size | 100mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2128.40 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
3-methoxy-1,5-diphenylpentan-1-one (CAS 51238-86-9) is a chemical compound with the molecular formula C18H20O2 and a molecular weight of 268.3 g/mol. IUPAC name: 3-methoxy-1,5-diphenylpentan-1-one. InChIKey: NORAXXZWLVRTBQ-UHFFFAOYSA-N.
| Molecular formula | C18H20O2 |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | 3-methoxy-1,5-diphenylpentan-1-one |
| InChIKey | NORAXXZWLVRTBQ-UHFFFAOYSA-N |
| SMILES | COC(CCC1=CC=CC=C1)CC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)