Products 1048367-61-8
CAS 1048367-61-8 is the registry number for 4'-tert-Butyl-6-methylbiphenyl-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-(4-tert-butylphenyl)-3-methylbenzoic acid (CAS 1048367-61-8) is a chemical compound with the molecular formula C18H20O2 and a molecular weight of 268.3 g/mol. IUPAC name: 2-(4-tert-butylphenyl)-3-methylbenzoic acid. InChIKey: BBGRXPKSMIQJIT-UHFFFAOYSA-N.
| Molecular formula | C18H20O2 |
|---|---|
| Molecular weight | 268.3 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)-3-methylbenzoic acid |
| InChIKey | BBGRXPKSMIQJIT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(=O)O)C2=CC=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)