cas: 755026-96-1 — see every product listed under this CAS number, including other names
3-Methoxy-4-nitrophenylboronic acid, pinacol ester, 96%, 96% (CAS 755026-96-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G8JE-100mg |
| cas | 755026-96-1 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 861.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-(3-methoxy-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 755026-96-1) is a chemical compound with the molecular formula C13H18BNO5 and a molecular weight of 279.10 g/mol. IUPAC name: 2-(3-methoxy-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BWLMLFOPBJWHOQ-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO5 |
|---|---|
| Molecular weight | 279.10 g/mol |
| IUPAC name | 2-(3-methoxy-4-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | BWLMLFOPBJWHOQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)