cas: 906008-22-8 — see every product listed under this CAS number, including other names
3-Methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol, 97% (CAS 906008-22-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627279-100MG |
| cas | 906008-22-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 737.26 Pln | |
| Fluorochem | 250mg | 1158.98 Pln | |
| Fluorochem | 500mg | 1794.18 Pln | |
| Fluorochem | 1g | 2497.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 906008-22-8) is a chemical compound with the molecular formula C13H19BO4 and a molecular weight of 250.10 g/mol. IUPAC name: 3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: CCAYVXOPUWTCNL-UHFFFAOYSA-N.
| Molecular formula | C13H19BO4 |
|---|---|
| Molecular weight | 250.10 g/mol |
| IUPAC name | 3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | CCAYVXOPUWTCNL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)OC)O |
Computed by PubChem (NCBI)