cas: 1201806-19-0 — see every product listed under this CAS number, including other names
3-Methoxyphenylglyoxal hydrate, 95%(LC-MS),RG, 95%(LC-MS),RG (CAS 1201806-19-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HFA6-250mg |
| cas | 1201806-19-0 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 410.00 Pln | |
| Chemat | 5g | 1120.40 Pln |
| purity | 95%(LC-MS),RG |
|---|---|
| delivery time | 3 weeks |
2-(3-methoxyphenyl)-2-oxoacetaldehyde;hydrate (CAS 1201806-19-0) is a chemical compound with the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. IUPAC name: 2-(3-methoxyphenyl)-2-oxoacetaldehyde;hydrate. InChIKey: LDMLATLMTDGBHP-UHFFFAOYSA-N.
| Molecular formula | C9H10O4 |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 2-(3-methoxyphenyl)-2-oxoacetaldehyde;hydrate |
| InChIKey | LDMLATLMTDGBHP-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C(=O)C=O.O |
Computed by PubChem (NCBI)