cas: 112900-82-0 — see every product listed under this CAS number, including other names
3-Methyl-4-morpholinoaniline, 97% (CAS 112900-82-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F338414-100MG |
| cas | 112900-82-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 331.15 Pln | |
| Fluorochem | 5g | 1315.18 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-methyl-4-morpholin-4-ylaniline (CAS 112900-82-0) is a chemical compound with the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. IUPAC name: 3-methyl-4-morpholin-4-ylaniline. InChIKey: KNOTXXUXSBIPQW-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O |
|---|---|
| Molecular weight | 192.26 g/mol |
| IUPAC name | 3-methyl-4-morpholin-4-ylaniline |
| InChIKey | KNOTXXUXSBIPQW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N)N2CCOCC2 |
Computed by PubChem (NCBI)