cas: 261952-04-9 — see every product listed under this CAS number, including other names
3-Methyl-5-(trifluoromethyl)benzonitrile 98+% (CAS 261952-04-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A392678-250mg |
| cas | 261952-04-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1327.12 Pln |
| purity | 98+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A392678 |
3-methyl-5-(trifluoromethyl)benzonitrile (CAS 261952-04-9) is a chemical compound with the molecular formula C9H6F3N and a molecular weight of 185.15 g/mol. IUPAC name: 3-methyl-5-(trifluoromethyl)benzonitrile. InChIKey: CSJHJNBBWUGJFY-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N |
|---|---|
| Molecular weight | 185.15 g/mol |
| IUPAC name | 3-methyl-5-(trifluoromethyl)benzonitrile |
| InChIKey | CSJHJNBBWUGJFY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(F)(F)F)C#N |
Computed by PubChem (NCBI)