cas: 643-93-6 — see every product listed under this CAS number, including other names
3-Methylbiphenyl 95% (CAS 643-93-6) is a chemical reagent available from Chemat. Available pack sizes: 100g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A460701-100g |
| cas | 643-93-6 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 3507.62 Pln | |
| Ambeed | 5g | 409.31 Pln | |
| Ambeed | 25g | 1143.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A460701 |
1-methyl-3-phenylbenzene (CAS 643-93-6) is a chemical compound with the molecular formula C13H12 and a molecular weight of 168.23 g/mol. IUPAC name: 1-methyl-3-phenylbenzene. InChIKey: NPDIDUXTRAITDE-UHFFFAOYSA-N.
| Molecular formula | C13H12 |
|---|---|
| Molecular weight | 168.23 g/mol |
| IUPAC name | 1-methyl-3-phenylbenzene |
| InChIKey | NPDIDUXTRAITDE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)