cas: 643-93-6 — see every product listed under this CAS number, including other names
3-Methylbiphenyl, >95.0%(GC) (CAS 643-93-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M0296-1G |
| cas | 643-93-6 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 167.52 Pln | |
| TCI | 5g | 487.14 Pln | |
| TCI | 25g | 1534.51 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(GC) |
1-methyl-3-phenylbenzene (CAS 643-93-6) is a chemical compound with the molecular formula C13H12 and a molecular weight of 168.23 g/mol. IUPAC name: 1-methyl-3-phenylbenzene. InChIKey: NPDIDUXTRAITDE-UHFFFAOYSA-N.
| Molecular formula | C13H12 |
|---|---|
| Molecular weight | 168.23 g/mol |
| IUPAC name | 1-methyl-3-phenylbenzene |
| InChIKey | NPDIDUXTRAITDE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)