cas: 1218791-11-7 — see every product listed under this CAS number, including other names
3-Nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 1218791-11-7) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F218952-5G |
| cas | 1218791-11-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 2075.33 Pln |
| delivery time | 3-4 weeks |
|---|
3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 1218791-11-7) is a chemical compound with the molecular formula C13H16BNO6 and a molecular weight of 293.08 g/mol. IUPAC name: 3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: PKZUOPKSOXRIRN-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO6 |
|---|---|
| Molecular weight | 293.08 g/mol |
| IUPAC name | 3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | PKZUOPKSOXRIRN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)