CAS 1218791-11-7 appears in our catalog under these names: 4-Carboxy-2-nitrophenylboronic acid, pinacol ester, 98%, 3-Nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 5g, 1g.
3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 1218791-11-7) is a chemical compound with the molecular formula C13H16BNO6 and a molecular weight of 293.08 g/mol. IUPAC name: 3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: PKZUOPKSOXRIRN-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO6 |
|---|---|
| Molecular weight | 293.08 g/mol |
| IUPAC name | 3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | PKZUOPKSOXRIRN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)