cas: 775351-58-1 — see every product listed under this CAS number, including other names
3-Nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile 95% (CAS 775351-58-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A741349-250mg |
| cas | 775351-58-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 248.00 Pln | |
| Ambeed | 5g | 654.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A741349 |
3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 775351-58-1) is a chemical compound with the molecular formula C13H15BN2O4 and a molecular weight of 274.08 g/mol. IUPAC name: 3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: PNQFLPGHZXHUKN-UHFFFAOYSA-N.
| Molecular formula | C13H15BN2O4 |
|---|---|
| Molecular weight | 274.08 g/mol |
| IUPAC name | 3-nitro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | PNQFLPGHZXHUKN-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)