CAS 1218791-28-6 appears in our catalog under these names: 2-Cyano-5-nitrophenylboronic acid, pinacol ester, 97%, 2-Cyano-5-nitrophenylboronic acid, pinacol. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 250mg, 25mg.
4-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 1218791-28-6) is a chemical compound with the molecular formula C13H15BN2O4 and a molecular weight of 274.08 g/mol. IUPAC name: 4-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: JPOBIUGNFDSEOW-UHFFFAOYSA-N.
| Molecular formula | C13H15BN2O4 |
|---|---|
| Molecular weight | 274.08 g/mol |
| IUPAC name | 4-nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | JPOBIUGNFDSEOW-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)