cas: 377780-80-8 — see every product listed under this CAS number, including other names
3-Nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid, 98% (CAS 377780-80-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219513-1G |
| cas | 377780-80-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 357.18 Pln | |
| Fluorochem | 25g | 1580.71 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (CAS 377780-80-8) is a chemical compound with the molecular formula C13H16BNO6 and a molecular weight of 293.08 g/mol. IUPAC name: 3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid. InChIKey: OYMDMSRXMZRHPB-UHFFFAOYSA-N.
| Molecular formula | C13H16BNO6 |
|---|---|
| Molecular weight | 293.08 g/mol |
| IUPAC name | 3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| InChIKey | OYMDMSRXMZRHPB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)