cas: 1392812-18-8 — see every product listed under this CAS number, including other names
3-Nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 98% (CAS 1392812-18-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F867206-100MG |
| cas | 1392812-18-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 164.54 Pln | |
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 529.00 Pln | |
| Fluorochem | 5g | 1716.08 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 1392812-18-8) is a chemical compound with the molecular formula C13H15BN2O4 and a molecular weight of 274.08 g/mol. IUPAC name: 3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: YBBZZEWSMUSYDY-UHFFFAOYSA-N.
| Molecular formula | C13H15BN2O4 |
|---|---|
| Molecular weight | 274.08 g/mol |
| IUPAC name | 3-nitro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | YBBZZEWSMUSYDY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)