cas: 349-78-0 — see every product listed under this CAS number, including other names
3-Nitrobenzenesulphonyl fluoride, 98% (CAS 349-78-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F954897-5G |
| cas | 349-78-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 289.50 Pln | |
| Fluorochem | 10g | 476.93 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3-nitrobenzenesulfonyl fluoride (CAS 349-78-0) is a chemical compound with the molecular formula C6H4FNO4S and a molecular weight of 205.17 g/mol. IUPAC name: 3-nitrobenzenesulfonyl fluoride. InChIKey: CWFLJNDQTKMBAM-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO4S |
|---|---|
| Molecular weight | 205.17 g/mol |
| IUPAC name | 3-nitrobenzenesulfonyl fluoride |
| InChIKey | CWFLJNDQTKMBAM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)