cas: 3346-63-2 — see every product listed under this CAS number, including other names
3-Nitropyridine-2,6-diamine 98% (CAS 3346-63-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A484054-250mg |
| cas | 3346-63-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 286.94 Pln | |
| Ambeed | 5g | 987.81 Pln | |
| Ambeed | 10g | 1744.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A484054 |
3-nitropyridine-2,6-diamine (CAS 3346-63-2) is a chemical compound with the molecular formula C5H6N4O2 and a molecular weight of 154.13 g/mol. IUPAC name: 3-nitropyridine-2,6-diamine. InChIKey: TZEVSKPZTQIPLS-UHFFFAOYSA-N.
| Molecular formula | C5H6N4O2 |
|---|---|
| Molecular weight | 154.13 g/mol |
| IUPAC name | 3-nitropyridine-2,6-diamine |
| InChIKey | TZEVSKPZTQIPLS-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1[N+](=O)[O-])N)N |
Computed by PubChem (NCBI)