CAS 2586-99-4 appears in our catalog under these names: 5-Nitropyridine-2,4-diamine, 95%, 5–Nitropyridine–2,4–diamine, 5-Nitropyridine-2,4-diamine, 95%, 95%, 5-Nitropyridine-2,4-diamine, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg.
5-nitropyridine-2,4-diamine (CAS 2586-99-4) is a chemical compound with the molecular formula C5H6N4O2 and a molecular weight of 154.13 g/mol. IUPAC name: 5-nitropyridine-2,4-diamine. InChIKey: SXBHXFMYNOLWEC-UHFFFAOYSA-N.
| Molecular formula | C5H6N4O2 |
|---|---|
| Molecular weight | 154.13 g/mol |
| IUPAC name | 5-nitropyridine-2,4-diamine |
| InChIKey | SXBHXFMYNOLWEC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1N)[N+](=O)[O-])N |
Computed by PubChem (NCBI)