cas: 1334177-80-8 — see every product listed under this CAS number, including other names
3-Oxo-1-phenyl-2,7,10,13,16,19,22-heptaoxa-4-azapentacosan-25-oic acid, 98% (CAS 1334177-80-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F867310-100MG |
| cas | 1334177-80-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 737.26 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-[2-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1334177-80-8) is a chemical compound with the molecular formula C23H37NO10 and a molecular weight of 487.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: QWAOJWRYJPALAN-UHFFFAOYSA-N.
| Molecular formula | C23H37NO10 |
|---|---|
| Molecular weight | 487.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | QWAOJWRYJPALAN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)