cas: 1334177-80-8 — see every product listed under this CAS number, including other names
Cbz-NH-PEG6-C2-acid 95% (CAS 1334177-80-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A755064-100mg |
| cas | 1334177-80-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 153.44 Pln | |
| Ambeed | 250mg | 259.12 Pln | |
| Ambeed | 1g | 587.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A755064 |
3-[2-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1334177-80-8) is a chemical compound with the molecular formula C23H37NO10 and a molecular weight of 487.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: QWAOJWRYJPALAN-UHFFFAOYSA-N.
| Molecular formula | C23H37NO10 |
|---|---|
| Molecular weight | 487.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | QWAOJWRYJPALAN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)