cas: 89424-17-9 — see every product listed under this CAS number, including other names
3-Oxo-3-(2-trifluoromethylphenyl)propionic acidethyl ester (CAS 89424-17-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F014857-250MG |
| cas | 89424-17-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 456.11 Pln | |
| Fluorochem | 1g | 1008.00 Pln | |
| Fluorochem | 5g | 2996.88 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | no data |
Ethyl 3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate (CAS 89424-17-9) is a chemical compound with the molecular formula C12H11F3O3 and a molecular weight of 260.21 g/mol. IUPAC name: ethyl 3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate. InChIKey: KMPAHDWULITWIH-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O3 |
|---|---|
| Molecular weight | 260.21 g/mol |
| IUPAC name | ethyl 3-oxo-3-[2-(trifluoromethyl)phenyl]propanoate |
| InChIKey | KMPAHDWULITWIH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC=CC=C1C(F)(F)F |
Computed by PubChem (NCBI)