CAS 1717-42-6 appears in our catalog under these names: 3-Oxo-3-(3-trifluoromethylphenyl)propionic acid ethyl ester, 97%, Ethyl 3-oxo-3-(3-(trifluoromethyl)phenyl)propanoate, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 250mg.
Ethyl 3-oxo-3-[3-(trifluoromethyl)phenyl]propanoate (CAS 1717-42-6) is a chemical compound with the molecular formula C12H11F3O3 and a molecular weight of 260.21 g/mol. IUPAC name: ethyl 3-oxo-3-[3-(trifluoromethyl)phenyl]propanoate. InChIKey: YCHPVUWFIZXXPI-UHFFFAOYSA-N.
| Molecular formula | C12H11F3O3 |
|---|---|
| Molecular weight | 260.21 g/mol |
| IUPAC name | ethyl 3-oxo-3-[3-(trifluoromethyl)phenyl]propanoate |
| InChIKey | YCHPVUWFIZXXPI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC(=CC=C1)C(F)(F)F |
Computed by PubChem (NCBI)