cas: 104239-97-6 — see every product listed under this CAS number, including other names
3-Oxo-4-aza-5α-androst-1-ene-17β-carboxylic acid, 98%, 98% (CAS 104239-97-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119RBC-250mg |
| cas | 104239-97-6 |
| size | 250mg |
| availability | 196.75g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 194.00 Pln | |
| Chemat | 10g | 314.00 Pln | |
| Chemat | 25g | 640.40 Pln | |
| Chemat | 100g | 2128.40 Pln | |
| Chemat | 50g | 1178.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(1S,3aS,3bS,5aR,9aR,9bS,11aS)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxylic acid (CAS 104239-97-6) is a chemical compound with the molecular formula C19H27NO3 and a molecular weight of 317.4 g/mol. IUPAC name: (1S,3aS,3bS,5aR,9aR,9bS,11aS)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxylic acid. InChIKey: FDESQZBVTKLIQN-MLGOENBGSA-N.
| Molecular formula | C19H27NO3 |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | (1S,3aS,3bS,5aR,9aR,9bS,11aS)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxylic acid |
| InChIKey | FDESQZBVTKLIQN-MLGOENBGSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2C(=O)O)CC[C@@H]4[C@@]3(C=CC(=O)N4)C |
Computed by PubChem (NCBI)