CAS 104239-97-6 appears in our catalog under these names: 4-Aza-5a-androstan-1-ene-3-one-17b-carboxylic acid, 97%, Dutasteride EP Impurity A (Finasteride Impurity 1), Refer to D-3512, Finasteride Impurity 1 (Dutasteride EP Impurity A), Finasteride Acid, >95% (HPLC), Finasteride Acid. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, Biosynth. Available pack sizes: 100g, 10g, 5g, 25g, 1g, on request, 4x25mg, 25mg.
(1S,3aS,3bS,5aR,9aR,9bS,11aS)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxylic acid (CAS 104239-97-6) is a chemical compound with the molecular formula C19H27NO3 and a molecular weight of 317.4 g/mol. IUPAC name: (1S,3aS,3bS,5aR,9aR,9bS,11aS)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxylic acid. InChIKey: FDESQZBVTKLIQN-MLGOENBGSA-N.
| Molecular formula | C19H27NO3 |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | (1S,3aS,3bS,5aR,9aR,9bS,11aS)-9a,11a-dimethyl-7-oxo-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinoline-1-carboxylic acid |
| InChIKey | FDESQZBVTKLIQN-MLGOENBGSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2C(=O)O)CC[C@@H]4[C@@]3(C=CC(=O)N4)C |
Computed by PubChem (NCBI)