cas: 1260664-94-5 — see every product listed under this CAS number, including other names
3-Oxoisoindoline-5-carbaldehyde 95% (CAS 1260664-94-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A241575-100mg |
| cas | 1260664-94-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 531.69 Pln | |
| Ambeed | 250mg | 759.75 Pln | |
| Ambeed | 1g | 1649.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A241575 |
3-oxo-1,2-dihydroisoindole-5-carbaldehyde (CAS 1260664-94-5) is a chemical compound with the molecular formula C9H7NO2 and a molecular weight of 161.16 g/mol. IUPAC name: 3-oxo-1,2-dihydroisoindole-5-carbaldehyde. InChIKey: CLDCSOQPDZYABK-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2 |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 3-oxo-1,2-dihydroisoindole-5-carbaldehyde |
| InChIKey | CLDCSOQPDZYABK-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)C=O)C(=O)N1 |
Computed by PubChem (NCBI)