cas: 1171992-10-1 — see every product listed under this CAS number, including other names
3-PHENOXYPIPERIDINE HYDROCHLORIDE, 97% (CAS 1171992-10-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F306042-100MG |
| cas | 1171992-10-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 513.38 Pln | |
| Fluorochem | 250mg | 789.32 Pln | |
| Fluorochem | 1g | 1851.45 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-phenoxypiperidine;hydrochloride (CAS 1171992-10-1) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 3-phenoxypiperidine;hydrochloride. InChIKey: NOIVAVLUDPXIBM-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 3-phenoxypiperidine;hydrochloride |
| InChIKey | NOIVAVLUDPXIBM-UHFFFAOYSA-N |
| SMILES | C1CC(CNC1)OC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)