cas: 955-10-2 — see every product listed under this CAS number, including other names
3-PHENYLCOUMARIN, 95%, 95% (CAS 955-10-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12E0D7-100mg |
| cas | 955-10-2 |
| size | 100mg |
| availability | 170g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 352.40 Pln | |
| Chemat | 5g | 1240.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
3-phenylchromen-2-one (CAS 955-10-2) is a chemical compound with the molecular formula C15H10O2 and a molecular weight of 222.24 g/mol. IUPAC name: 3-phenylchromen-2-one. InChIKey: HWDSXZLYIKESML-UHFFFAOYSA-N.
| Molecular formula | C15H10O2 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 3-phenylchromen-2-one |
| InChIKey | HWDSXZLYIKESML-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=CC=CC=C3OC2=O |
Computed by PubChem (NCBI)